C24H22FN5O2 — CID 46698674
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-oxoacetamide (PubChem CID 46698674) has the molecular formula C24H22FN5O2 and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-oxoacetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 46698674 |
| Molecular Formula | C24H22FN5O2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NC(c1ccc(F)cc1)c1nccn1C |
| InChI | InChI=1S/C24H22FN5O2/c1-15-20(16(2)30(28-15)19-7-5-4-6-8-19)22(31)24(32)27-21(23-26-13-14-29(23)3)17-9-11-18(25)12-10-17/h4-14,21H,1-3H3,(H,27,32) |
| InChIKey | PUFCDMFLAQSOPJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|