C28H25FN4O3 — CID 55916937
N-[4-[1-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]ethyl]phenyl]-4-fluorobenzamide (PubChem CID 55916937) has the molecular formula C28H25FN4O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[4-[1-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]ethyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[1-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]ethyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55916937 |
| Molecular Formula | C28H25FN4O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[4-[1-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]ethyl]phenyl]-4-fluorobenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NC(C)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H25FN4O3/c1-17(20-11-15-23(16-12-20)31-27(35)21-9-13-22(29)14-10-21)30-28(36)26(34)25-18(2)32-33(19(25)3)24-7-5-4-6-8-24/h4-17H,1-3H3,(H,30,36)(H,31,35) |
| InChIKey | NJOZFGGEWWRXHC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|