C26H25N5O3S — CID 55468361
N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 55468361) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 55468361 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[4-[4-(1-acetamidoethyl)phenyl]-1,3-thiazol-2-yl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | CC(=O)NC(C)c1ccc(-c2csc(NC(=O)C(=O)c3c(C)nn(-c4ccccc4)c3C)n2)cc1 |
| InChI | InChI=1S/C26H25N5O3S/c1-15(27-18(4)32)19-10-12-20(13-11-19)22-14-35-26(28-22)29-25(34)24(33)23-16(2)30-31(17(23)3)21-8-6-5-7-9-21/h5-15H,1-4H3,(H,27,32)(H,28,29,34) |
| InChIKey | ABODHWCFJAAXSJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|