C23H22N4O3 — CID 26059043
N-[4-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 26059043) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[4-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 26059043 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[4-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)Nc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-14-20(15(2)27(26-14)19-6-4-3-5-7-19)21(28)23(30)25-18-12-10-17(11-13-18)24-22(29)16-8-9-16/h3-7,10-13,16H,8-9H2,1-2H3,(H,24,29)(H,25,30) |
| InChIKey | FGBNQWPHNQFNGL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|