C24H28N4O2 — CID 46449018
N-[3-(diethylaminomethyl)phenyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 46449018) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[3-(diethylaminomethyl)phenyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | N-[3-(diethylaminomethyl)phenyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 46449018 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[3-(diethylaminomethyl)phenyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | CCN(CC)Cc1cccc(NC(=O)C(=O)c2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C24H28N4O2/c1-5-27(6-2)16-19-11-10-12-20(15-19)25-24(30)23(29)22-17(3)26-28(18(22)4)21-13-8-7-9-14-21/h7-15H,5-6,16H2,1-4H3,(H,25,30) |
| InChIKey | XPTMAKPLPLRSQM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|