C22H20N6O2 — CID 55855750
N-(1-benzyl-1,2,4-triazol-3-yl)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 55855750) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 55855750 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)Nc1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C22H20N6O2/c1-15-19(16(2)28(25-15)18-11-7-4-8-12-18)20(29)21(30)24-22-23-14-27(26-22)13-17-9-5-3-6-10-17/h3-12,14H,13H2,1-2H3,(H,24,26,30) |
| InChIKey | ZZMBCYCKYMXBPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|