C28H26N4O3 — CID 55493349
2-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 55493349) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55493349 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]amino]-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)C(=O)c2c(C)nn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C28H26N4O3/c1-18-13-15-21(16-14-18)17-29-27(34)23-11-7-8-12-24(23)30-28(35)26(33)25-19(2)31-32(20(25)3)22-9-5-4-6-10-22/h4-16H,17H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | GLWBSVJBZKHTKX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|