C22H20N4O — CID 20892655
N-benzyl-3-methyl-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20892655) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is N-benzyl-3-methyl-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-benzyl-3-methyl-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20892655 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-benzyl-3-methyl-1-phenyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(-n2cccc2)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H20N4O/c1-17-20(21(27)23-16-18-10-4-2-5-11-18)22(25-14-8-9-15-25)26(24-17)19-12-6-3-7-13-19/h2-15H,16H2,1H3,(H,23,27) |
| InChIKey | MGDMMPBJSPVDQB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |