C20H18N4OS — CID 20892701
3-methyl-1-phenyl-5-pyrrol-1-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 20892701) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-methyl-1-phenyl-5-pyrrol-1-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 3-methyl-1-phenyl-5-pyrrol-1-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20892701 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-methyl-1-phenyl-5-pyrrol-1-yl-N-(thiophen-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(-n2cccc2)c1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C20H18N4OS/c1-15-18(19(25)21-14-17-10-7-13-26-17)20(23-11-5-6-12-23)24(22-15)16-8-3-2-4-9-16/h2-13H,14H2,1H3,(H,21,25) |
| InChIKey | WUXFPVIQXQRLPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |