C28H31N5O — CID 20915182
N-(1-benzylpiperidin-4-yl)-3-methyl-1-(4-methylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 20915182) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-methyl-1-(4-methylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-methyl-1-(4-methylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 20915182 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-methyl-1-(4-methylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2nc(C)c(C(=O)NC3CCN(Cc4ccccc4)CC3)c2-n2cccc2)cc1 |
| InChI | InChI=1S/C28H31N5O/c1-21-10-12-25(13-11-21)33-28(32-16-6-7-17-32)26(22(2)30-33)27(34)29-24-14-18-31(19-15-24)20-23-8-4-3-5-9-23/h3-13,16-17,24H,14-15,18-20H2,1-2H3,(H,29,34) |
| InChIKey | NUHJXVSCIYMNTJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |