C20H17FN4O3 — CID 51274472
N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]-2-fluorobenzohydrazide (PubChem CID 51274472) has the molecular formula C20H17FN4O3 and a molecular weight of 380.38 g/mol. Its IUPAC name is N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 51274472 |
| Molecular Formula | C20H17FN4O3 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetyl]-2-fluorobenzohydrazide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H17FN4O3/c1-12-17(13(2)25(24-12)14-8-4-3-5-9-14)18(26)20(28)23-22-19(27)15-10-6-7-11-16(15)21/h3-11H,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | MQBWITKAGPYETE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|