C25H22N4O3 — CID 55879441
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(6-phenylmethoxy-3-pyridinyl)acetamide (PubChem CID 55879441) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(6-phenylmethoxy-3-pyridinyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(6-phenylmethoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 55879441 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(6-phenylmethoxy-3-pyridinyl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)Nc1ccc(OCc2ccccc2)nc1 |
| InChI | InChI=1S/C25H22N4O3/c1-17-23(18(2)29(28-17)21-11-7-4-8-12-21)24(30)25(31)27-20-13-14-22(26-15-20)32-16-19-9-5-3-6-10-19/h3-15H,16H2,1-2H3,(H,27,31) |
| InChIKey | DZZHVYOASHIUDL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|