C26H22N4O2 — CID 18227715
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]acetamide (PubChem CID 18227715) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 18227715 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)Nc1cccc(/C=C/c2ccccn2)c1 |
| InChI | InChI=1S/C26H22N4O2/c1-18-24(19(2)30(29-18)23-12-4-3-5-13-23)25(31)26(32)28-22-11-8-9-20(17-22)14-15-21-10-6-7-16-27-21/h3-17H,1-2H3,(H,28,32)/b15-14+ |
| InChIKey | SLPYTJMMQYFFJJ-CCEZHUSRSA-N |
| XLogP | 4.88 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|