C30H27N5O2 — CID 24610608
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide (PubChem CID 24610608) has the molecular formula C30H27N5O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 24610608 |
| Molecular Formula | C30H27N5O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NCc1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C30H27N5O2/c1-21-27(22(2)35(32-21)26-16-10-5-11-17-26)29(36)30(37)31-18-25-20-34(19-23-12-6-3-7-13-23)33-28(25)24-14-8-4-9-15-24/h3-17,20H,18-19H2,1-2H3,(H,31,37) |
| InChIKey | GYLCKLBMNRVTBI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|