C23H21N3OS — CID 26117322
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-5-methylthiophene-2-carboxamide (PubChem CID 26117322) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 26117322 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCc2cn(Cc3ccccc3)nc2-c2ccccc2)s1 |
| InChI | InChI=1S/C23H21N3OS/c1-17-12-13-21(28-17)23(27)24-14-20-16-26(15-18-8-4-2-5-9-18)25-22(20)19-10-6-3-7-11-19/h2-13,16H,14-15H2,1H3,(H,24,27) |
| InChIKey | UZDWBPZXWOPDNU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |