C24H20N4O3 — CID 25488874
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-nitrobenzamide (PubChem CID 25488874) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-nitrobenzamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 25488874 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-nitrobenzamide |
| SMILES | O=C(NCc1cn(Cc2ccccc2)nc1-c1ccccc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20N4O3/c29-24(21-13-7-8-14-22(21)28(30)31)25-15-20-17-27(16-18-9-3-1-4-10-18)26-23(20)19-11-5-2-6-12-19/h1-14,17H,15-16H2,(H,25,29) |
| InChIKey | YBYPRMPLBJZFBR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|