C26H21N5O2 — CID 24610550
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 24610550) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 24610550 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NCc1cn(Cc2ccccc2)nc1-c1ccccc1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C26H21N5O2/c32-25-22-14-8-7-13-21(22)24(28-29-25)26(33)27-15-20-17-31(16-18-9-3-1-4-10-18)30-23(20)19-11-5-2-6-12-19/h1-14,17H,15-16H2,(H,27,33)(H,29,32) |
| InChIKey | GPSKRCGBTSTMSE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |