C27H25N5O3 — CID 42063019
4-[(1-benzyl-3-phenylpyrazol-4-yl)methylamino]-N-cyclopropyl-3-nitrobenzamide (PubChem CID 42063019) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-[(1-benzyl-3-phenylpyrazol-4-yl)methylamino]-N-cyclopropyl-3-nitrobenzamide.
| Compound Name | 4-[(1-benzyl-3-phenylpyrazol-4-yl)methylamino]-N-cyclopropyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42063019 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-[(1-benzyl-3-phenylpyrazol-4-yl)methylamino]-N-cyclopropyl-3-nitrobenzamide |
| SMILES | O=C(NC1CC1)c1ccc(NCc2cn(Cc3ccccc3)nc2-c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25N5O3/c33-27(29-23-12-13-23)21-11-14-24(25(15-21)32(34)35)28-16-22-18-31(17-19-7-3-1-4-8-19)30-26(22)20-9-5-2-6-10-20/h1-11,14-15,18,23,28H,12-13,16-17H2,(H,29,33) |
| InChIKey | FHTDZKBYBAVIQX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|