C14H18N4O — CID 94221424
(2S)-N-(1-benzyl-1,2,4-triazol-3-yl)-2-methylbutanamide (PubChem CID 94221424) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-N-(1-benzyl-1,2,4-triazol-3-yl)-2-methylbutanamide.
| Compound Name | (2S)-N-(1-benzyl-1,2,4-triazol-3-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 94221424 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2S)-N-(1-benzyl-1,2,4-triazol-3-yl)-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)Nc1ncn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4O/c1-3-11(2)13(19)16-14-15-10-18(17-14)9-12-7-5-4-6-8-12/h4-8,10-11H,3,9H2,1-2H3,(H,16,17,19)/t11-/m0/s1 |
| InChIKey | UYJYVMSZQSSJQI-NSHDSACASA-N |
| XLogP | 2.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |