C17H24N6O2 — CID 56823510
2-[(1-benzyl-1,2,4-triazol-3-yl)carbamoylamino]-N-tert-butylpropanamide (PubChem CID 56823510) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[(1-benzyl-1,2,4-triazol-3-yl)carbamoylamino]-N-tert-butylpropanamide.
| Compound Name | 2-[(1-benzyl-1,2,4-triazol-3-yl)carbamoylamino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 56823510 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 2-[(1-benzyl-1,2,4-triazol-3-yl)carbamoylamino]-N-tert-butylpropanamide |
| SMILES | CC(NC(=O)Nc1ncn(Cc2ccccc2)n1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H24N6O2/c1-12(14(24)21-17(2,3)4)19-16(25)20-15-18-11-23(22-15)10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3,(H,21,24)(H2,19,20,22,25) |
| InChIKey | XRDSRKFVAYTGLR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |