C31H48FNO3Si — CID 22005097
methyl 5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]-2-fluorobenzoate (PubChem CID 22005097) has the molecular formula C31H48FNO3Si and a molecular weight of 529.81 g/mol. Its IUPAC name is methyl 5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]-2-fluorobenzoate.
| Compound Name | methyl 5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 22005097 |
| Molecular Formula | C31H48FNO3Si |
| Molecular Weight | 529.81 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | methyl 5-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-pentyl-2,6-di(propan-2-yl)-4-pyridinyl]-2-fluorobenzoate |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO[Si](C)(C)C(C)(C)C)c1-c1ccc(F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C31H48FNO3Si/c1-12-13-14-15-23-27(22-16-17-26(32)24(18-22)30(34)35-9)25(19-36-37(10,11)31(6,7)8)29(21(4)5)33-28(23)20(2)3/h16-18,20-21H,12-15,19H2,1-11H3 |
| InChIKey | OZHCVHLHUOWFMJ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.81 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|