C23H24FNO2 — CID 15924228
(E)-3-[4-(4-fluorophenyl)-5-[(E)-3-oxoprop-1-enyl]-2,6-di(propan-2-yl)-3-pyridinyl]prop-2-enal (PubChem CID 15924228) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is (E)-3-[4-(4-fluorophenyl)-5-[(E)-3-oxoprop-1-enyl]-2,6-di(propan-2-yl)-3-pyridinyl]prop-2-enal.
| Compound Name | (E)-3-[4-(4-fluorophenyl)-5-[(E)-3-oxoprop-1-enyl]-2,6-di(propan-2-yl)-3-pyridinyl]prop-2-enal |
|---|---|
| PubChem CID | 15924228 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (E)-3-[4-(4-fluorophenyl)-5-[(E)-3-oxoprop-1-enyl]-2,6-di(propan-2-yl)-3-pyridinyl]prop-2-enal |
| SMILES | CC(C)c1nc(C(C)C)c(/C=C/C=O)c(-c2ccc(F)cc2)c1/C=C/C=O |
| InChI | InChI=1S/C23H24FNO2/c1-15(2)22-19(7-5-13-26)21(17-9-11-18(24)12-10-17)20(8-6-14-27)23(25-22)16(3)4/h5-16H,1-4H3/b7-5+,8-6+ |
| InChIKey | OHNCNNKVDYYQQH-KQQUZDAGSA-N |
| XLogP | 5.56 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|