C22H23FO3 — CID 22404359
(E)-3-[6-(4-fluorophenyl)-7-hydroxy-2,2-dimethyl-4-propan-2-yl-3H-1-benzofuran-5-yl]prop-2-enal (PubChem CID 22404359) has the molecular formula C22H23FO3 and a molecular weight of 354.42 g/mol. Its IUPAC name is (E)-3-[6-(4-fluorophenyl)-7-hydroxy-2,2-dimethyl-4-propan-2-yl-3H-1-benzofuran-5-yl]prop-2-enal.
| Compound Name | (E)-3-[6-(4-fluorophenyl)-7-hydroxy-2,2-dimethyl-4-propan-2-yl-3H-1-benzofuran-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 22404359 |
| Molecular Formula | C22H23FO3 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-3-[6-(4-fluorophenyl)-7-hydroxy-2,2-dimethyl-4-propan-2-yl-3H-1-benzofuran-5-yl]prop-2-enal |
| SMILES | CC(C)c1c(/C=C/C=O)c(-c2ccc(F)cc2)c(O)c2c1CC(C)(C)O2 |
| InChI | InChI=1S/C22H23FO3/c1-13(2)18-16(6-5-11-24)19(14-7-9-15(23)10-8-14)20(25)21-17(18)12-22(3,4)26-21/h5-11,13,25H,12H2,1-4H3/b6-5+ |
| InChIKey | GSEYDNWIDZYDRU-AATRIKPKSA-N |
| XLogP | 5.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|