C26H23FN2O — CID 173371968
3-[2-(4-fluorophenyl)-7-methyl-5-phenyl-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal (PubChem CID 173371968) has the molecular formula C26H23FN2O and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-7-methyl-5-phenyl-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal.
| Compound Name | 3-[2-(4-fluorophenyl)-7-methyl-5-phenyl-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 173371968 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-7-methyl-5-phenyl-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal |
| SMILES | Cc1cc(-c2ccccc2)c2c(C(C)C)c(C=CC=O)c(-c3ccc(F)cc3)nn12 |
| InChI | InChI=1S/C26H23FN2O/c1-17(2)24-22(10-7-15-30)25(20-11-13-21(27)14-12-20)28-29-18(3)16-23(26(24)29)19-8-5-4-6-9-19/h4-17H,1-3H3 |
| InChIKey | RKBXTFPESYRAFZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|