C19H15Cl2FN2O — CID 173371963
3-[5,7-dichloro-2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal (PubChem CID 173371963) has the molecular formula C19H15Cl2FN2O and a molecular weight of 377.25 g/mol. Its IUPAC name is 3-[5,7-dichloro-2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal.
| Compound Name | 3-[5,7-dichloro-2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 173371963 |
| Molecular Formula | C19H15Cl2FN2O |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 3-[5,7-dichloro-2-(4-fluorophenyl)-4-propan-2-ylpyrrolo[1,2-b]pyridazin-3-yl]prop-2-enal |
| SMILES | CC(C)c1c(C=CC=O)c(-c2ccc(F)cc2)nn2c(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C19H15Cl2FN2O/c1-11(2)17-14(4-3-9-25)18(12-5-7-13(22)8-6-12)23-24-16(21)10-15(20)19(17)24/h3-11H,1-2H3 |
| InChIKey | MMRPIWNVEREPOR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|