C18H20FN3O3S — CID 123707101
1-[4-(4-fluorophenyl)-5-(3-oxoprop-1-enyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide (PubChem CID 123707101) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-5-(3-oxoprop-1-enyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide.
| Compound Name | 1-[4-(4-fluorophenyl)-5-(3-oxoprop-1-enyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 123707101 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-5-(3-oxoprop-1-enyl)-6-propan-2-ylpyrimidin-2-yl]-N-methylmethanesulfonamide |
| SMILES | CNS(=O)(=O)Cc1nc(-c2ccc(F)cc2)c(C=CC=O)c(C(C)C)n1 |
| InChI | InChI=1S/C18H20FN3O3S/c1-12(2)17-15(5-4-10-23)18(13-6-8-14(19)9-7-13)22-16(21-17)11-26(24,25)20-3/h4-10,12,20H,11H2,1-3H3 |
| InChIKey | OLPMLQNDGQVRIC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|