C16H17FN2O2S — CID 141456297
methyl 4-(4-fluorophenyl)-6-propan-2-yl-2-(sulfanylmethyl)pyrimidine-5-carboxylate (PubChem CID 141456297) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-6-propan-2-yl-2-(sulfanylmethyl)pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-6-propan-2-yl-2-(sulfanylmethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 141456297 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-6-propan-2-yl-2-(sulfanylmethyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)nc(CS)nc1C(C)C |
| InChI | InChI=1S/C16H17FN2O2S/c1-9(2)14-13(16(20)21-3)15(19-12(8-22)18-14)10-4-6-11(17)7-5-10/h4-7,9,22H,8H2,1-3H3 |
| InChIKey | QVCRHWDIEVRHNN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|