C20H26FN3O2 — CID 11530572
ethyl 2-(diethylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate (PubChem CID 11530572) has the molecular formula C20H26FN3O2 and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl 2-(diethylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(diethylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11530572 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | ethyl 2-(diethylamino)-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)nc(N(CC)CC)nc1C(C)C |
| InChI | InChI=1S/C20H26FN3O2/c1-6-24(7-2)20-22-17(13(4)5)16(19(25)26-8-3)18(23-20)14-9-11-15(21)12-10-14/h9-13H,6-8H2,1-5H3 |
| InChIKey | SAXHUABHEKORAU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |