C13H13FN2O2 — CID 69402118
ethyl 3-(4-fluorophenyl)-4-methyl-1H-pyrazole-5-carboxylate (PubChem CID 69402118) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-4-methyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(4-fluorophenyl)-4-methyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 69402118 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-4-methyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C13H13FN2O2/c1-3-18-13(17)12-8(2)11(15-16-12)9-4-6-10(14)7-5-9/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | AFCAYVHQDUYAEP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |