C14H15FN2O2 — CID 68709761
ethyl 5-(4-fluorophenyl)-1,4-dimethylpyrazole-3-carboxylate (PubChem CID 68709761) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is ethyl 5-(4-fluorophenyl)-1,4-dimethylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-fluorophenyl)-1,4-dimethylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 68709761 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 5-(4-fluorophenyl)-1,4-dimethylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C)c(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C14H15FN2O2/c1-4-19-14(18)12-9(2)13(17(3)16-12)10-5-7-11(15)8-6-10/h5-8H,4H2,1-3H3 |
| InChIKey | IGBOLYFJJIBZJE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |