C15H20N2O2 — CID 171093697
ethane;ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 171093697) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethane;ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethane;ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 171093697 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethane;ethyl 4-methyl-3-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CC.CCOC(=O)c1[nH]nc(-c2ccccc2)c1C |
| InChI | InChI=1S/C13H14N2O2.C2H6/c1-3-17-13(16)12-9(2)11(14-15-12)10-7-5-4-6-8-10;1-2/h4-8H,3H2,1-2H3,(H,14,15);1-2H3 |
| InChIKey | PBICZYPJXHNBJJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |