About methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate
methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate (PubChem CID 14955472) has the molecular formula C19H23FN2O5
and a molecular weight of 378.40 g/mol. Its IUPAC name is methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate |
| PubChem CID | 14955472 |
| Molecular Formula | C19H23FN2O5 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C(C)C)nc(-c2ccc(F)cc2)n(CC(OC)OC)c1=O |
| InChI | InChI=1S/C19H23FN2O5/c1-11(2)16-15(19(24)27-5)18(23)22(10-14(25-3)26-4)17(21-16)12-6-8-13(20)9-7-12/h6-9,11,14H,10H2,1-5H3 |
| InChIKey | JRTPMFGUGVBMCI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate?
The IUPAC name of methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate (CID 14955472) is methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate.
What is the SMILES notation for methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate?
The canonical SMILES for methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate is COC(=O)c1c(C(C)C)nc(-c2ccc(F)cc2)n(CC(OC)OC)c1=O.
What is the InChIKey of methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate?
The InChIKey is JRTPMFGUGVBMCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23FN2O5/c1-11(2)16-15(19(24)27-5)18(23)22(10-14(25-3)26-4)17(21-16)12-6-8-13(20)9-7-12/h6-9,11,14H,10H2,1-5H3.
What are the key properties of methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate?
methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate has a molecular weight of 378.40 g/mol, XLogP of 2.58, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,2-dimethoxyethyl)-2-(4-fluorophenyl)-6-oxo-4-propan-2-ylpyrimidine-5-carboxylate is sourced from PubChem (CID 14955472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).