C15H17N3O5 — CID 10381261
methyl 1-(2,2-dimethoxyethyl)-6-oxo-2-pyridin-3-ylpyrimidine-5-carboxylate (PubChem CID 10381261) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 1-(2,2-dimethoxyethyl)-6-oxo-2-pyridin-3-ylpyrimidine-5-carboxylate.
| Compound Name | methyl 1-(2,2-dimethoxyethyl)-6-oxo-2-pyridin-3-ylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10381261 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 1-(2,2-dimethoxyethyl)-6-oxo-2-pyridin-3-ylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(-c2cccnc2)n(CC(OC)OC)c1=O |
| InChI | InChI=1S/C15H17N3O5/c1-21-12(22-2)9-18-13(10-5-4-6-16-7-10)17-8-11(14(18)19)15(20)23-3/h4-8,12H,9H2,1-3H3 |
| InChIKey | BVEMVXIHWOQOCQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|