C12H15N3O2 — CID 44604866
3-[1-(2,2-dimethoxyethyl)imidazol-4-yl]pyridine (PubChem CID 44604866) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[1-(2,2-dimethoxyethyl)imidazol-4-yl]pyridine.
| Compound Name | 3-[1-(2,2-dimethoxyethyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 44604866 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-[1-(2,2-dimethoxyethyl)imidazol-4-yl]pyridine |
| SMILES | COC(Cn1cnc(-c2cccnc2)c1)OC |
| InChI | InChI=1S/C12H15N3O2/c1-16-12(17-2)8-15-7-11(14-9-15)10-4-3-5-13-6-10/h3-7,9,12H,8H2,1-2H3 |
| InChIKey | FKMOFLOEOBVLGO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|