C15H20IN3 — CID 139311770
3-[1-(5-iodo-5-methylhexyl)imidazol-4-yl]pyridine (PubChem CID 139311770) has the molecular formula C15H20IN3 and a molecular weight of 369.25 g/mol. Its IUPAC name is 3-[1-(5-iodo-5-methylhexyl)imidazol-4-yl]pyridine.
| Compound Name | 3-[1-(5-iodo-5-methylhexyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 139311770 |
| Molecular Formula | C15H20IN3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 3-[1-(5-iodo-5-methylhexyl)imidazol-4-yl]pyridine |
| SMILES | CC(C)(I)CCCCn1cnc(-c2cccnc2)c1 |
| InChI | InChI=1S/C15H20IN3/c1-15(2,16)7-3-4-9-19-11-14(18-12-19)13-6-5-8-17-10-13/h5-6,8,10-12H,3-4,7,9H2,1-2H3 |
| InChIKey | NBBOMAUQXDLZGD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|