C17H20N2O5 — CID 22405492
ethyl 1-(2,2-dimethoxyethyl)-2-oxo-6-pyridin-3-ylpyridine-3-carboxylate (PubChem CID 22405492) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 1-(2,2-dimethoxyethyl)-2-oxo-6-pyridin-3-ylpyridine-3-carboxylate.
| Compound Name | ethyl 1-(2,2-dimethoxyethyl)-2-oxo-6-pyridin-3-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 22405492 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 1-(2,2-dimethoxyethyl)-2-oxo-6-pyridin-3-ylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2cccnc2)n(CC(OC)OC)c1=O |
| InChI | InChI=1S/C17H20N2O5/c1-4-24-17(21)13-7-8-14(12-6-5-9-18-10-12)19(16(13)20)11-15(22-2)23-3/h5-10,15H,4,11H2,1-3H3 |
| InChIKey | YMDZVHNSCFBNSY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|