C19H23NO6 — CID 132821656
methyl 1-(2,2-dimethoxyethyl)-2-(2-methoxy-2-oxoethyl)-5-phenylpyrrole-3-carboxylate (PubChem CID 132821656) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl 1-(2,2-dimethoxyethyl)-2-(2-methoxy-2-oxoethyl)-5-phenylpyrrole-3-carboxylate.
| Compound Name | methyl 1-(2,2-dimethoxyethyl)-2-(2-methoxy-2-oxoethyl)-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132821656 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | methyl 1-(2,2-dimethoxyethyl)-2-(2-methoxy-2-oxoethyl)-5-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)Cc1c(C(=O)OC)cc(-c2ccccc2)n1CC(OC)OC |
| InChI | InChI=1S/C19H23NO6/c1-23-17(21)11-16-14(19(22)26-4)10-15(13-8-6-5-7-9-13)20(16)12-18(24-2)25-3/h5-10,18H,11-12H2,1-4H3 |
| InChIKey | YSXBLDNUPBZPHI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|