C20H27NO2 — CID 102196268
ethyl 1-butyl-5-phenyl-2-propylpyrrole-3-carboxylate (PubChem CID 102196268) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is ethyl 1-butyl-5-phenyl-2-propylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-butyl-5-phenyl-2-propylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102196268 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ethyl 1-butyl-5-phenyl-2-propylpyrrole-3-carboxylate |
| SMILES | CCCCn1c(-c2ccccc2)cc(C(=O)OCC)c1CCC |
| InChI | InChI=1S/C20H27NO2/c1-4-7-14-21-18(11-5-2)17(20(22)23-6-3)15-19(21)16-12-9-8-10-13-16/h8-10,12-13,15H,4-7,11,14H2,1-3H3 |
| InChIKey | YLGHWWPMDWWXBX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |