C29H36N2O3 — CID 142013889
ethyl 2-butyl-1-[(E)-(3-butyl-2-hydroxy-5-methylphenyl)methylideneamino]-5-phenylpyrrole-3-carboxylate (PubChem CID 142013889) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is ethyl 2-butyl-1-[(E)-(3-butyl-2-hydroxy-5-methylphenyl)methylideneamino]-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-butyl-1-[(E)-(3-butyl-2-hydroxy-5-methylphenyl)methylideneamino]-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 142013889 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | ethyl 2-butyl-1-[(E)-(3-butyl-2-hydroxy-5-methylphenyl)methylideneamino]-5-phenylpyrrole-3-carboxylate |
| SMILES | CCCCc1cc(C)cc(/C=N/n2c(-c3ccccc3)cc(C(=O)OCC)c2CCCC)c1O |
| InChI | InChI=1S/C29H36N2O3/c1-5-8-13-23-17-21(4)18-24(28(23)32)20-30-31-26(16-9-6-2)25(29(33)34-7-3)19-27(31)22-14-11-10-12-15-22/h10-12,14-15,17-20,32H,5-9,13,16H2,1-4H3/b30-20+ |
| InChIKey | STTUSEISTNRQBI-TWKHWXDSSA-N |
| XLogP | 6.91 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|