C20H18N2O3 — CID 163830402
ethyl 2-methyl-1-(2-nitrosophenyl)-5-phenylpyrrole-3-carboxylate (PubChem CID 163830402) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is ethyl 2-methyl-1-(2-nitrosophenyl)-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-1-(2-nitrosophenyl)-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 163830402 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | ethyl 2-methyl-1-(2-nitrosophenyl)-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2ccccc2N=O)c1C |
| InChI | InChI=1S/C20H18N2O3/c1-3-25-20(23)16-13-19(15-9-5-4-6-10-15)22(14(16)2)18-12-8-7-11-17(18)21-24/h4-13H,3H2,1-2H3 |
| InChIKey | ODERBIXZNLMKQO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|