C28H26N2O3 — CID 3322551
ethyl 2-methyl-1-[3-[(3-methylphenyl)carbamoyl]phenyl]-5-phenylpyrrole-3-carboxylate (PubChem CID 3322551) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethyl 2-methyl-1-[3-[(3-methylphenyl)carbamoyl]phenyl]-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-1-[3-[(3-methylphenyl)carbamoyl]phenyl]-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3322551 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | ethyl 2-methyl-1-[3-[(3-methylphenyl)carbamoyl]phenyl]-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)Nc3cccc(C)c3)c2)c1C |
| InChI | InChI=1S/C28H26N2O3/c1-4-33-28(32)25-18-26(21-11-6-5-7-12-21)30(20(25)3)24-15-9-13-22(17-24)27(31)29-23-14-8-10-19(2)16-23/h5-18H,4H2,1-3H3,(H,29,31) |
| InChIKey | MKVFFWVORLBZQQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|