C20H16F3NO2 — CID 134834275
ethyl 1,5-diphenyl-2-(trifluoromethyl)pyrrole-3-carboxylate (PubChem CID 134834275) has the molecular formula C20H16F3NO2 and a molecular weight of 359.35 g/mol. Its IUPAC name is ethyl 1,5-diphenyl-2-(trifluoromethyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1,5-diphenyl-2-(trifluoromethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134834275 |
| Molecular Formula | C20H16F3NO2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | ethyl 1,5-diphenyl-2-(trifluoromethyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO2/c1-2-26-19(25)16-13-17(14-9-5-3-6-10-14)24(18(16)20(21,22)23)15-11-7-4-8-12-15/h3-13H,2H2,1H3 |
| InChIKey | SIZASGFLCWPVGD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|