C29H28N2O3 — CID 4621410
ethyl 2-methyl-5-phenyl-1-[3-(2-phenylethylcarbamoyl)phenyl]pyrrole-3-carboxylate (PubChem CID 4621410) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 2-methyl-5-phenyl-1-[3-(2-phenylethylcarbamoyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-phenyl-1-[3-(2-phenylethylcarbamoyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4621410 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | ethyl 2-methyl-5-phenyl-1-[3-(2-phenylethylcarbamoyl)phenyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)NCCc3ccccc3)c2)c1C |
| InChI | InChI=1S/C29H28N2O3/c1-3-34-29(33)26-20-27(23-13-8-5-9-14-23)31(21(26)2)25-16-10-15-24(19-25)28(32)30-18-17-22-11-6-4-7-12-22/h4-16,19-20H,3,17-18H2,1-2H3,(H,30,32) |
| InChIKey | VOEUJODHDJHFDV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|