C20H19NO5S — CID 10200089
3-(3-ethoxycarbonyl-2-methyl-5-phenylpyrrol-1-yl)benzenesulfonic acid (PubChem CID 10200089) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-(3-ethoxycarbonyl-2-methyl-5-phenylpyrrol-1-yl)benzenesulfonic acid.
| Compound Name | 3-(3-ethoxycarbonyl-2-methyl-5-phenylpyrrol-1-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 10200089 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-(3-ethoxycarbonyl-2-methyl-5-phenylpyrrol-1-yl)benzenesulfonic acid |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(S(=O)(=O)O)c2)c1C |
| InChI | InChI=1S/C20H19NO5S/c1-3-26-20(22)18-13-19(15-8-5-4-6-9-15)21(14(18)2)16-10-7-11-17(12-16)27(23,24)25/h4-13H,3H2,1-2H3,(H,23,24,25) |
| InChIKey | VFSNETYYNUPOTF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|