C25H26N2O3 — CID 3322552
ethyl 2-methyl-5-phenyl-1-[3-(pyrrolidine-1-carbonyl)phenyl]pyrrole-3-carboxylate (PubChem CID 3322552) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is ethyl 2-methyl-5-phenyl-1-[3-(pyrrolidine-1-carbonyl)phenyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-phenyl-1-[3-(pyrrolidine-1-carbonyl)phenyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3322552 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | ethyl 2-methyl-5-phenyl-1-[3-(pyrrolidine-1-carbonyl)phenyl]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(-c2cccc(C(=O)N3CCCC3)c2)c1C |
| InChI | InChI=1S/C25H26N2O3/c1-3-30-25(29)22-17-23(19-10-5-4-6-11-19)27(18(22)2)21-13-9-12-20(16-21)24(28)26-14-7-8-15-26/h4-6,9-13,16-17H,3,7-8,14-15H2,1-2H3 |
| InChIKey | MNHUUEWJCGRVCY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|