C25H34N2O3 — CID 20969594
ethyl 2-methyl-1-[4-[(4-methylcyclohexyl)amino]-4-oxobutyl]-5-phenylpyrrole-3-carboxylate (PubChem CID 20969594) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is ethyl 2-methyl-1-[4-[(4-methylcyclohexyl)amino]-4-oxobutyl]-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-1-[4-[(4-methylcyclohexyl)amino]-4-oxobutyl]-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 20969594 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | ethyl 2-methyl-1-[4-[(4-methylcyclohexyl)amino]-4-oxobutyl]-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(CCCC(=O)NC2CCC(C)CC2)c1C |
| InChI | InChI=1S/C25H34N2O3/c1-4-30-25(29)22-17-23(20-9-6-5-7-10-20)27(19(22)3)16-8-11-24(28)26-21-14-12-18(2)13-15-21/h5-7,9-10,17-18,21H,4,8,11-16H2,1-3H3,(H,26,28) |
| InChIKey | UBDHSHFGQTYILR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |