C24H26N2O4 — CID 4620061
ethyl 1-[3-(4-methoxyanilino)-3-oxopropyl]-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 4620061) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 1-[3-(4-methoxyanilino)-3-oxopropyl]-2-methyl-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-[3-(4-methoxyanilino)-3-oxopropyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4620061 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 1-[3-(4-methoxyanilino)-3-oxopropyl]-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n(CCC(=O)Nc2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C24H26N2O4/c1-4-30-24(28)21-16-22(18-8-6-5-7-9-18)26(17(21)2)15-14-23(27)25-19-10-12-20(29-3)13-11-19/h5-13,16H,4,14-15H2,1-3H3,(H,25,27) |
| InChIKey | UCTNEKIYDQJMBF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |