C25H28N2O4 — CID 20969586
ethyl 1-[4-(4-methoxyanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 20969586) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is ethyl 1-[4-(4-methoxyanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[4-(4-methoxyanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 20969586 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | ethyl 1-[4-(4-methoxyanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C)cc2)n(CCCC(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H28N2O4/c1-4-31-25(29)20-16-23(19-9-7-18(2)8-10-19)27(17-20)15-5-6-24(28)26-21-11-13-22(30-3)14-12-21/h7-14,16-17H,4-6,15H2,1-3H3,(H,26,28) |
| InChIKey | QXELIEZCNAWHCJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |