C25H27BrN2O3 — CID 20969578
ethyl 1-[4-(4-bromo-3-methylanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 20969578) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is ethyl 1-[4-(4-bromo-3-methylanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[4-(4-bromo-3-methylanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 20969578 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 1-[4-(4-bromo-3-methylanilino)-4-oxobutyl]-5-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C)cc2)n(CCCC(=O)Nc2ccc(Br)c(C)c2)c1 |
| InChI | InChI=1S/C25H27BrN2O3/c1-4-31-25(30)20-15-23(19-9-7-17(2)8-10-19)28(16-20)13-5-6-24(29)27-21-11-12-22(26)18(3)14-21/h7-12,14-16H,4-6,13H2,1-3H3,(H,27,29) |
| InChIKey | FLRRAWFAZQHHIY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |