C29H21F5N4O2 — CID 139747248
methyl 5-[azido-(2,3,4-trifluorophenyl)methyl]-2,4-bis(4-fluorophenyl)-6-propan-2-ylpyridine-3-carboxylate (PubChem CID 139747248) has the molecular formula C29H21F5N4O2 and a molecular weight of 552.50 g/mol. Its IUPAC name is methyl 5-[azido-(2,3,4-trifluorophenyl)methyl]-2,4-bis(4-fluorophenyl)-6-propan-2-ylpyridine-3-carboxylate.
| Compound Name | methyl 5-[azido-(2,3,4-trifluorophenyl)methyl]-2,4-bis(4-fluorophenyl)-6-propan-2-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 139747248 |
| Molecular Formula | C29H21F5N4O2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | methyl 5-[azido-(2,3,4-trifluorophenyl)methyl]-2,4-bis(4-fluorophenyl)-6-propan-2-ylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)nc(C(C)C)c(C(N=[N+]=[N-])c2ccc(F)c(F)c2F)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H21F5N4O2/c1-14(2)26-22(28(37-38-35)19-12-13-20(32)25(34)24(19)33)21(15-4-8-17(30)9-5-15)23(29(39)40-3)27(36-26)16-6-10-18(31)11-7-16/h4-14,28H,1-3H3 |
| InChIKey | WGWSPBPDIAKRDW-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 87.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|